Bromotris(dimethylamino)phosphonium hexafluorophosphate
- Product NameBromotris(dimethylamino)phosphonium hexafluorophosphate
- CAS50296-37-2
- MFC6H18BrF6N3P2
- MW388.07
- EINECS
- MOL File50296-37-2.mol
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H18BrN3P.F6P/c1-8(2)11(7,9(3)4)10(5)6;1-7(2,3,4,5)6/h1-6H3;/q+1;-1 |
| InChIKey | XELPBWPBGHCIKX-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[P+](Br)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 50296-37-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 45-34 |
| Safety Statements | 53-26-36/37/39-45 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29299090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Carc. 1B Skin Corr. 1B |
