Bromotris(dimethylamino)phosphonium hexafluorophosphate
- Product NameBromotris(dimethylamino)phosphonium hexafluorophosphate
- CAS50296-37-2
- CBNumberCB3264207
- MFC6H18BrF6N3P2
- MW388.07
- MDL NumberMFCD00191864
- MOL File50296-37-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | >300 °C(lit.) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| color | White to Almost white |
| Sensitive | Light Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H18BrN3P.F6P/c1-8(2)11(7,9(3)4)10(5)6;1-7(2,3,4,5)6/h1-6H3;/q+1;-1 |
| InChIKey | XELPBWPBGHCIKX-UHFFFAOYSA-N |
| SMILES | [P-](F)(F)(F)(F)(F)F.[P+](Br)(N(C)C)(N(C)C)N(C)C |
| CAS DataBase Reference | 50296-37-2(CAS DataBase Reference) |
| UNSPSC Code | 12352101 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H350-H318 | |||||||||
| Precautionary statements | P260-P264-P301+P330+P331+P310-P303+P361+P353+P310+P363-P304+P340+P310-P305+P351+P338+P310-P405-P501-P260h-P301+P330+P331-P303+P361+P353-P501a-P201-P280-P305+P351+P338-P310 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 45-34 | |||||||||
| Safety Statements | 53-26-36/37/39-45 | |||||||||
| RIDADR | UN 3263 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29299090 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Carc. 1B Skin Corr. 1B | |||||||||
| NFPA 704: |
|
