2-Hydroxy-4-quinolincarboxylic acid
- Product Name2-Hydroxy-4-quinolincarboxylic acid
- CAS15733-89-8
- MFC10H7NO3
- MW189.17
- EINECS239-827-9
- MOL File15733-89-8.mol
Chemical Properties
| Melting point | 350°C |
| Boiling point | 403.6±45.0 °C(Predicted) |
| Density | 1.429±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 2.76±0.20(Predicted) |
| color | Yellow to Dark Yellow |
| BRN | 148331 |
| InChI | InChI=1S/C10H7NO3/c12-9-5-7(10(13)14)6-3-1-2-4-8(6)11-9/h1-5H,(H,11,12)(H,13,14) |
| InChIKey | MFSHNFBQNVGXJX-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(O)=O)=CC1=O |
| LogP | 0.3 at 25℃ and pH7 |
| CAS DataBase Reference | 15733-89-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36 |
| WGK Germany | WGK 3 |
| RTECS | GD3869000 |
| HazardClass | IRRITANT |
| HS Code | 29337900 |
| Storage Class | 13 - Non Combustible Solids |
| Toxicity | mouse,LD,intraperitoneal,> 500mg/kg (500mg/kg),"Summary Tables of Biological Tests," National Research Council Chemical-Biological Coordination Center. Vol. 5, Pg. 338, 1953. |