Methyl nitroacetate
- Product NameMethyl nitroacetate
- CAS2483-57-0
- MFC3H5NO4
- MW119.08
- EINECS219-622-0
- MOL File2483-57-0.mol
Chemical Properties
| Boiling point | 195-198 °C (lit.) |
| Density | 1.294 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 221 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Miscible with ethanol, ether and most organic solvents. |
| pka | 5.73±0.29(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Light Sensitive |
| BRN | 1758670 |
| InChI | InChI=1S/C3H5NO4/c1-8-3(5)2-4(6)7/h2H2,1H3 |
| InChIKey | ALBSWLMUHHZLLR-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C[N+]([O-])=O |
| CAS DataBase Reference | 2483-57-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, nitro-, methyl ester(2483-57-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 2 |
| RTECS | AJ1093000 |
| F | 8 |
| HS Code | 29161995 |
