2-Amino-6-methylbenzoic acid
- Product Name2-Amino-6-methylbenzoic acid
- CAS4389-50-8
- MFC8H9NO2
- MW151.16
- EINECS629-030-8
- MOL File4389-50-8.mol
Chemical Properties
| Melting point | 128-130 °C (dec.) (lit.) |
| Boiling point | 273.17°C (rough estimate) |
| Density | 1.2023 (rough estimate) |
| refractive index | 1.5810 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in methanol. |
| pka | 1.95±0.31(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Dark green |
| BRN | 2803391 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H9NO2/c1-5-3-2-4-6(9)7(5)8(10)11/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | XHYVBIXKORFHFM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=C(C)C=CC=C1N |
| CAS DataBase Reference | 4389-50-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
