3-Nitrophthalic acid
- Product Name3-Nitrophthalic acid
- CAS603-11-2
- MFC8H5NO6
- MW211.13
- EINECS210-030-8
- MOL File603-11-2.mol
Chemical Properties
| Melting point | 210 °C (dec.) (lit.) |
| Boiling point | 350.79°C (rough estimate) |
| Density | 1.6342 (rough estimate) |
| vapor density | 7.3 (vs air) |
| refractive index | 1.5282 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | water: soluble5%, clear to slightly hazy, colorless to faint yellow or tan |
| form | Powder |
| pka | pK1:1.88 (25°C) |
| color | Off-white to light yellow |
| Water Solubility | 20 g/L (25 ºC) |
| Decomposition | 216 °C |
| BRN | 2054269 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H5NO6/c10-7(11)4-2-1-3-5(9(14)15)6(4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | KFIRODWJCYBBHY-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(c1C(O)=O)[N+]([O-])=O |
| CAS DataBase Reference | 603-11-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41 |
| Safety Statements | 26-36/39-37/39-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29173980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |