Furfuryl glycidyl ether
- Product NameFurfuryl glycidyl ether
- CAS5380-87-0
- MFC8H10O3
- MW154.16
- EINECS226-372-6
- MOL File5380-87-0.mol
Chemical Properties
| Boiling point | 103-104 °C/11 mmHg (lit.) |
| Density | 1.122 g/mL at 25 °C |
| refractive index | n |
| Flash point | 216 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| color | Colorless to yellow to orange |
| InChI | InChI=1S/C8H10O3/c1-2-7(10-3-1)4-9-5-8-6-11-8/h1-3,8H,4-6H2 |
| InChIKey | RUGWIVARLJMKDM-UHFFFAOYSA-N |
| SMILES | O1C=CC=C1COCC1CO1 |
| CAS DataBase Reference | 5380-87-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20-19 |
| Safety Statements | 23-18-24/25 |
| WGK Germany | 3 |
| RTECS | LU1423000 |
| HS Code | 29321900 |
| Storage Class | 10 - Combustible liquids |
