| Melting point |
102-105 °C |
| Boiling point |
194.6°C (rough estimate) |
| Density |
1.1497 (rough estimate) |
| refractive index |
1.3920 (estimate) |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
DMF: 5mg/mL; DMSO: 25mg/mL; PBS (pH 7.2): 5mg/mL |
| pka |
13.24±0.20(Predicted) |
| form |
Fine Crystalline Powder |
| color |
White |
| PH |
5.5-7.0 (100g/l, H2O, 25℃) |
| Water Solubility |
Soluble in water (100 mg/ml). |
| Sensitive |
Hygroscopic |
| Merck |
14,168 |
| BRN |
1720524 |
| Henry's Law Constant |
4.6×1011 mol/(m3Pa) at 25℃, Compernolle and Müller (2014) |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4+,5- |
| InChIKey |
HEBKCHPVOIAQTA-ZXFHETKHSA-N |
| SMILES |
OC[C@H](O)[C@H](O)[C@H](O)CO |
| LogP |
-3.770 (est) |
| CAS DataBase Reference |
488-81-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Ribitol (488-81-3) |
