Potassium pyrosulfate
- Product NamePotassium pyrosulfate
- CAS7790-62-7
- MFK2O7S2
- MW254.32
- EINECS232-216-8
- MOL File7790-62-7.mol
Chemical Properties
| Melting point | 325 °C |
| bulk density | 830kg/m3 |
| Density | 2.28 g/mL at 25 °C (lit.) |
| storage temp. | no restrictions. |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Solid |
| Specific Gravity | 2.28 |
| color | White |
| PH | 0.8 (50g/l, H2O, 20℃) |
| Odor | Odorless |
| PH Range | 1 - 2 at 25.5 g/l at 25 °C |
| Water Solubility | MAY DECOMPOSE |
| Sensitive | Hygroscopic |
| Merck | 14,7664 |
| Stability | Stable. Incompatible with strong acids, strong bases. |
| InChI | 1S/2K.H2O7S2/c;;1-8(2,3)7-9(4,5)6/h;;(H,1,2,3)(H,4,5,6)/q2*+1;/p-2 |
| InChIKey | KAQHZJVQFBJKCK-UHFFFAOYSA-L |
| SMILES | [K+].[K+].[O-]S(=O)(=O)OS([O-])(=O)=O |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3260 8/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2833 29 80 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Eye Dam. 1 Skin Corr. 1A |
