Polystyrene sulfonic acid
- Product NamePolystyrene sulfonic acid
- CAS28210-41-5
- MFC8H8O3S
- MW184.21
- EINECS411-200-6
- MOL File28210-41-5.mol
Chemical Properties
| Melting point | 1°C |
| Boiling point | 100°C |
| Density | 1.11 g/mL at 25 °C |
| refractive index | n |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: soluble |
| form | Liquid |
| color | Amber |
| PH | 1.55 (25℃) |
| Water Solubility | Miscible with water, ethanol, methanol, lower alcohols and glycols. |
| Exposure limits | ACGIH: TWA 0.2 mg/m3 OSHA: TWA 1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 1 mg/m3 |
| InChI | InChI=1S/C8H8O3S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h2-6H,1H2,(H,9,10,11) |
| InChIKey | MAGFQRLKWCCTQJ-UHFFFAOYSA-N |
| SMILES | S(C1C=CC(C=C)=CC=1)(O)(=O)=O |
| EPA Substance Registry System | Benzenesulfonic acid, 4-ethenyl-, homopolymer (28210-41-5) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-35 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 2586 8/PG 3 |
| WGK Germany | - |
| TSCA | TSCA listed |
| HazardClass | 8 |
| Storage Class | 8B - Non-combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Inhalation Eye Dam. 1 Skin Corr. 1A |