7-Aminoheptanoic acid
- Product Name7-Aminoheptanoic acid
- CAS929-17-9
- MFC7H15NO2
- MW145.2
- EINECS213-197-5
- MOL File929-17-9.mol
Chemical Properties
| Melting point | 192-195 °C (lit.) |
| Boiling point | 270.6±23.0 °C(Predicted) |
| Density | 1.019±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | pK1: 4.502 (25°C) |
| color | White to Almost white |
| BRN | 906887 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H15NO2/c8-6-4-2-1-3-5-7(9)10/h1-6,8H2,(H,9,10) |
| InChIKey | XDOLZJYETYVRKV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCCCCN |
| CAS DataBase Reference | 929-17-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 7-Aminoheptanoic acid(929-17-9) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 2 |
| RTECS | MJ1770000 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
