Isopropyl 3-aminocrotonate
- Product NameIsopropyl 3-aminocrotonate
- CAS14205-46-0
- MFC7H13NO2
- MW143.18
- EINECS604-269-0
- MOL File14205-46-0.mol
Chemical Properties
| Melting point | 19-23°C |
| Boiling point | 80°C/1mmHg(lit.) |
| Density | 0.987±0.06 g/cm3(Predicted) |
| refractive index | 1.4870 to 1.4910 |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform, Ethyl Acetate, Methanol |
| form | Colourless Liquid |
| pka | 5.36±0.70(Predicted) |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C7H13NO2/c1-5(2)10-7(9)4-6(3)8/h4-5H,8H2,1-3H3 |
| InChIKey | YCKAGGHNUHZKCL-UHFFFAOYSA-N |
| SMILES | C(OC(C)C)(=O)C=C(N)C |
| CAS DataBase Reference | 14205-46-0(CAS DataBase Reference) |