N-Methyldidecylamine
- Product NameN-Methyldidecylamine
- CAS7396-58-9
- MFC21H45N
- MW311.59
- EINECS230-990-1
- MOL File7396-58-9.mol
Chemical Properties
| Melting point | -7.4 °C |
| Boiling point | 145 °C / 2mmHg |
| Density | 0.807 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | 93°C |
| pka | 9.83±0.50(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | 1.2μg/L |
| BRN | 1765810 |
| InChI | InChI=1S/C21H45N/c1-4-6-8-10-12-14-16-18-20-22(3)21-19-17-15-13-11-9-7-5-2/h4-21H2,1-3H3 |
| InChIKey | ATBNMWWDBWBAHM-UHFFFAOYSA-N |
| SMILES | C(N(CCCCCCCCCC)C)CCCCCCCCC |
| LogP | 8.8 |
| CAS DataBase Reference | 7396-58-9 |
| EPA Substance Registry System | Didecylmethylamine (7396-58-9) |
Safety Information
| RIDADR | UN 2735 8/PG 3 |
| WGK Germany | 2 |
| F | 9-34 |
| TSCA | TSCA listed |
| HS Code | 2921.19.6190 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 |
