3,5-Dichlorobenzenesulfonyl chloride
- Product Name3,5-Dichlorobenzenesulfonyl chloride
- CAS705-21-5
- MFC6H3Cl3O2S
- MW245.51
- EINECS627-769-0
- MOL File705-21-5.mol
Chemical Properties
| Melting point | 32-35 °C (lit.) |
| Boiling point | 83-84°C 0,1mm |
| Density | 1.636±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1528657 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 705-21-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
