3,5-Dichlorobenzenesulfonyl chloride
- Product Name3,5-Dichlorobenzenesulfonyl chloride
- CAS705-21-5
- CBNumberCB2218894
- MFC6H3Cl3O2S
- MW245.51
- EINECS627-769-0
- MDL NumberMFCD00051698
- MOL File705-21-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 32-35 °C (lit.) |
| Boiling point | 83-84°C 0,1mm |
| Density | 1.636±0.06 g/cm3(Predicted) |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to lump |
| color | White to Light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 1528657 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-5(8)3-6(2-4)12(9,10)11/h1-3H |
| InChIKey | RJSQINMKOSOUGT-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)cc(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 705-21-5(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P305+P351+P338-P310 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 1759 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|
