| Melting point |
127-130 °C (lit.) |
| Boiling point |
348.55°C (rough estimate) |
| Density |
0.53 g/cm3 (23℃) |
| vapor pressure |
0.007Pa at 20℃ |
| refractive index |
1.5400 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
0.04g/l insoluble |
| form |
Powder or Crystals |
| pka |
1.26±0.10(Predicted) |
| color |
Beige or yellow to light green to brownish |
| PH |
6.9 (10g/l, H2O, 20℃) |
| Water Solubility |
Insoluble in water. |
| BRN |
2808505 |
| Stability |
Stable under recommended storage conditions., Stable Under Recommended Storage C |
| InChI |
1S/C10H11NO4/c1-14-9(12)6-3-4-7(8(11)5-6)10(13)15-2/h3-5H,11H2,1-2H3 |
| InChIKey |
DSSKDXUDARIMTR-UHFFFAOYSA-N |
| SMILES |
COC(=O)c1ccc(c(N)c1)C(=O)OC |
| LogP |
2.32 at 23℃ and pH7 |
| CAS DataBase Reference |
5372-81-6(CAS DataBase Reference) |
| NIST Chemistry Reference |
Aminoterephthalic acid, dimethyl ester(5372-81-6) |
| EPA Substance Registry System |
Dimethyl 2-aminoterephthalate (5372-81-6) |
