4-N-Boc-aminocyclohexanone
- Product Name4-N-Boc-aminocyclohexanone
- CAS179321-49-4
- MFC11H19NO3
- MW213.27
- EINECS672-405-6
- MOL File179321-49-4.mol
Chemical Properties
| Melting point | 114-118℃ |
| Boiling point | 335.9±31.0 °C(Predicted) |
| Density | 1.06±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 12.19±0.20(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C11H19NO3/c1-11(2,3)15-10(14)12-8-4-6-9(13)7-5-8/h8H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | WYVFPGFWUKBXPZ-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CCC(=O)CC1 |
| CAS DataBase Reference | 179321-49-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,N |
| Risk Statements | 36/37/38-50 |
| Safety Statements | 26-36/37/39-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29242990 |
