N-Benzylquininium chloride
- Product NameN-Benzylquininium chloride
- CAS67174-25-8
- MFC27H31ClN2O2
- MW451.01
- EINECS224-828-9
- MOL File67174-25-8.mol
Chemical Properties
| Melting point | 200-205 °C (dec.) (lit.) |
| refractive index | 227.5 ° (C=1.5, H2O) |
| storage temp. | 2-8°C |
| solubility | freely sol H2O, alcohols, acetone; slightly sol EtOAc; sparingly sol CHCl3 |
| form | powder to crystal |
| color | White to Light yellow |
| optical activity | [α]20/D 235°, c = 1.5 in H2O |
| BRN | 5702637 |
| InChIKey | JYDIJFKNXHPWBJ-GOGFHWEMSA-M |
| SMILES | [Cl-].COc1ccc2nccc([C@@H](O)[C@@H]3C[C@@H]4CC[N@+]3(C[C@@H]4C=C)Cc5ccccc5)c2c1 |
| CAS DataBase Reference | 67174-25-8 |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
