2-Cyanoethyl N,N-diisopropylchlorophosphoramidite
- Product Name2-Cyanoethyl N,N-diisopropylchlorophosphoramidite
- CAS89992-70-1
- MFC9H18ClN2OP
- MW236.68
- EINECS628-591-6
- MOL File89992-70-1.mol
Chemical Properties
| Boiling point | 103-105°C 0,08mm |
| Density | 1.061 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | −20°C |
| solubility | Miscible with chloroform and dichloromethane. |
| form | Crystalline Powder |
| pka | 0.83±0.70(Predicted) |
| color | clear to very slightly hazy colorless |
| Sensitive | Moisture Sensitive |
| BRN | 3588525 |
| Stability | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C9H18ClN2OP/c1-8(2)12(9(3)4)14(10)13-7-5-6-11/h8-9H,5,7H2,1-4H3 |
| InChIKey | QWTBDIBOOIAZEF-UHFFFAOYSA-N |
| SMILES | P(N(C(C)C)C(C)C)(Cl)OCCC#N |
| CAS DataBase Reference | 89992-70-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,T |
| Risk Statements | 5-34-29-20/21/22 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 2845 4.2/PG 1 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29299090 |
| Storage Class | 4.2 - Pyrophoric and self-heating hazardous materials |
| Hazard Classifications | Eye Dam. 1 Pyr. Liq. 1 Skin Corr. 1B |