| Boiling point |
103-105°C 0,08mm |
| Density |
1.061 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.479 |
| Flash point |
>230 °F |
| storage temp. |
−20°C |
| solubility |
Miscible with chloroform and dichloromethane. |
| form |
Crystalline Powder |
| pka |
0.83±0.70(Predicted) |
| color |
clear to very slightly hazy colorless |
| Sensitive |
Moisture Sensitive |
| BRN |
3588525 |
| Stability |
Hygroscopic, Moisture Sensitive |
| InChI |
InChI=1S/C9H18ClN2OP/c1-8(2)12(9(3)4)14(10)13-7-5-6-11/h8-9H,5,7H2,1-4H3 |
| InChIKey |
QWTBDIBOOIAZEF-UHFFFAOYSA-N |
| SMILES |
P(N(C(C)C)C(C)C)(Cl)OCCC#N |
| CAS DataBase Reference |
89992-70-1(CAS DataBase Reference) |
