4'-Chloro-3'-nitroacetophenone
- Product Name4'-Chloro-3'-nitroacetophenone
- CAS5465-65-6
- MFC8H6ClNO3
- MW199.59
- EINECS226-769-4
- MOL File5465-65-6.mol
Chemical Properties
| Melting point | 99-101 °C(lit.) |
| Boiling point | 160°C (rough estimate) |
| Density | 1.4125 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1640627 |
| InChI | 1S/C8H6ClNO3/c1-5(11)6-2-3-7(9)8(4-6)10(12)13/h2-4H,1H3 |
| InChIKey | YEVPHFIFGUWSMG-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 5465-65-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
