Dimethyl 2-oxoglutarate
- Product NameDimethyl 2-oxoglutarate
- CAS13192-04-6
- MFC7H10O5
- MW174.15
- EINECS
- MOL File13192-04-6.mol
Chemical Properties
| Boiling point | 90-95 °C0.4 mm Hg(lit.) |
| Density | 1.203 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | -20°C |
| solubility | DMF: 30 mg/ml,DMSO: 30 mg/ml,Ethanol: 30 mg/ml,PBS (pH 7.2): 10 mg/ml |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C7H10O5/c1-11-6(9)4-3-5(8)7(10)12-2/h3-4H2,1-2H3 |
| InChIKey | TXIXSLPEABAEHP-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(=O)CCC(OC)=O |
| CAS DataBase Reference | 13192-04-6(CAS DataBase Reference) |
