2,5-Difluorobenzyl bromide
- Product Name2,5-Difluorobenzyl bromide
- CAS85117-99-3
- MFC7H5BrF2
- MW207.02
- EINECS285-651-0
- MOL File85117-99-3.mol
Chemical Properties
| Boiling point | 28 °C |
| Density | 1.609 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 60 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.6090 |
| BRN | 7089248 |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| InChIKey | ONWGSWNHQZYCFK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1CBr |
| CAS DataBase Reference | 85117-99-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorobenzyl bromide(85117-99-3) |
Safety Information
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-34-22-36 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 Skin Corr. 1B |
