2,3-Difluorobenzoic acid
- Product Name2,3-Difluorobenzoic acid
- CAS4519-39-5
- MFC7H4F2O2
- MW158.1
- EINECS
- MOL File4519-39-5.mol
Chemical Properties
| Melting point | 163-165 °C (lit.) |
| Boiling point | 248.1±20.0 °C(Predicted) |
| Density | 1.3486 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 2.93±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | slightly soluble |
| BRN | 2640781 |
| InChI | InChI=1S/C7H4F2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
| InChIKey | JLZVIWSFUPLSOR-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(F)=C1F |
| CAS DataBase Reference | 4519-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2,3-difluoro- (4519-39-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |