| Melting point |
22 °C |
| Boiling point |
124-128 °C (4 mmHg) |
| Density |
1.0292 (rough estimate) |
| refractive index |
1.5378-1.5398 |
| Flash point |
124-128°C/4mm |
| storage temp. |
Store at room temperature |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Light yellow |
| BRN |
908286 |
| InChI |
InChI=1S/C11H14O2/c1-3-4-11(12)9-5-7-10(13-2)8-6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey |
JLCDSZXBELPBRD-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=C(OC)C=C1)(=O)CCC |
| CAS DataBase Reference |
4160-51-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
1-(4-Methoxyphenyl)-1-butanone(4160-51-4) |
