Perfluoropentanoic acid
- Product NamePerfluoropentanoic acid
- CAS2706-90-3
- MFC5HF9O2
- MW264.05
- EINECS220-300-7
- MOL File2706-90-3.mol
Chemical Properties
| Boiling point | 140 °C(lit.) |
| Density | 1.713 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 140°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 10 mg/ml DMSO: 10 mg/ml Ethanol: 10 mg/mlPBS (pH 7.2): 1 mg/ml |
| pka | 0.40±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.713 |
| color | Clear light yellow to light brown |
| Water Solubility | Partly soluble in water. |
| BRN | 1800087 |
| Henry's Law Constant | 6.7×10-1 mol/(m3Pa) at 25℃, Kwan (2001) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 2706-90-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Dam. 1 Repr. 2 |
