| Melting point |
88-91 °C (lit.) |
| Boiling point |
134-138 °C/3 mmHg (lit.) |
| Density |
1.6649 (estimate) |
| Flash point |
134-138°C/3mm |
| storage temp. |
Storage temp. 2-8°C |
| pka |
0.23±0.10(Predicted) |
| form |
powder to crystal |
| color |
White to Brown to Dark purple |
| Sensitive |
Hygroscopic |
| BRN |
1801049 |
| Stability |
hygroscopic |
| InChI |
1S/C5H2F6O4/c6-3(7,1(12)13)5(10,11)4(8,9)2(14)15/h(H,12,13)(H,14,15) |
| InChIKey |
CCUWGJDGLACFQT-UHFFFAOYSA-N |
| SMILES |
OC(=O)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference |
376-73-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Pentanedioic acid, hexafluoro- (376-73-8) |
