Perfluoropentanoic acid
- Product NamePerfluoropentanoic acid
- CAS2706-90-3
- CBNumberCB0456654
- MFC5HF9O2
- MW264.05
- EINECS220-300-7
- MDL NumberMFCD00040211
- MOL File2706-90-3.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 140 °C(lit.) |
| Density | 1.713 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 140°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMF: 10 mg/ml DMSO: 10 mg/ml Ethanol: 10 mg/mlPBS (pH 7.2): 1 mg/ml |
| pka | 0.40±0.10(Predicted) |
| form | Liquid |
| Specific Gravity | 1.713 |
| color | Clear light yellow to light brown |
| Water Solubility | Partly soluble in water. |
| BRN | 1800087 |
| Henry's Law Constant | 6.7×10-1 mol/(m3Pa) at 25℃, Kwan (2001) |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C5HF9O2/c6-2(7,1(15)16)3(8,9)4(10,11)5(12,13)14/h(H,15,16) |
| InChIKey | CXZGQIAOTKWCDB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 2706-90-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H318-H361d | |||||||||
| Precautionary statements | P201-P202-P280-P305+P351+P338-P308+P313-P405 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29159000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Eye Dam. 1 Repr. 2 | |||||||||
| NFPA 704: |
|
