3-Chloro-2-nitropyridine
- Product Name3-Chloro-2-nitropyridine
- CAS54231-32-2
- MFC5H3ClN2O2
- MW158.54
- EINECS678-886-9
- MOL File54231-32-2.mol
Chemical Properties
| Melting point | 90-91°C |
| Boiling point | 279.1±20.0 °C(Predicted) |
| Density | 1.489±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | -4.87±0.22(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 1637069 |
| InChI | InChI=1S/C5H3ClN2O2/c6-4-2-1-3-7-5(4)8(9)10/h1-3H |
| InChIKey | PSGASDJUCYTRAD-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=NC=CC=C1Cl |
| CAS DataBase Reference | 54231-32-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38-41-25 |
| Safety Statements | 26-36/37/39-36-45-39 |
| RIDADR | 2811 |
| PackingGroup | III |
| HS Code | 2933399990 |
