4-Nitrophenyl trifluoroacetate
- Product Name4-Nitrophenyl trifluoroacetate
- CAS658-78-6
- MFC8H4F3NO4
- MW235.12
- EINECS211-524-6
- MOL File658-78-6.mol
Chemical Properties
| Melting point | 35-39 °C (lit.) |
| Boiling point | 120 °C/12 mmHg (lit.) |
| Density | 1.5675 (estimate) |
| Flash point | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | almost transparency in Methanol |
| form | powder to lump to clear liquid |
| color | White or Colorless to Yellow |
| BRN | 658785 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C8H4F3NO4/c9-8(10,11)7(13)16-6-3-1-5(2-4-6)12(14)15/h1-4H |
| InChIKey | JFOIBTLTZWOAIC-UHFFFAOYSA-N |
| SMILES | C(OC1=CC=C([N+]([O-])=O)C=C1)(=O)C(F)(F)F |
| CAS DataBase Reference | 658-78-6(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, trifluoro-, 4-nitrophenyl ester (658-78-6) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| F | 21 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
