4-Nitrophenyl acetate
- Product Name4-Nitrophenyl acetate
- CAS830-03-5
- MFC8H7NO4
- MW181.15
- EINECS212-593-5
- MOL File830-03-5.mol
Chemical Properties
| Melting point | 75-77 °C (lit.) |
| Boiling point | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| vapor pressure | 1.28Pa at 20℃ |
| refractive index | 1.5468 (estimate) |
| storage temp. | -20°C |
| solubility | 0.53g/l |
| form | Powder |
| color | Green |
| Water Solubility | Insoluble in water. |
| BRN | 515874 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H7NO4/c1-6(10)13-8-4-2-7(3-5-8)9(11)12/h2-5H,1H3 |
| InChIKey | QAUUDNIGJSLPSX-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1ccc(cc1)OC(=O)C |
| LogP | 1.58 at 25℃ and pH6.83 |
| CAS DataBase Reference | 830-03-5(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, 4-nitrophenyl ester (830-03-5) |
Safety Information
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 24/25-45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | AJ1150000 |
| TSCA | TSCA listed |
| HS Code | 29153900 |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Eye Dam. 1 Ox. Sol. 3 Skin Sens. 1 |
| Toxicity | LD50 ivn-mus: 180 mg/kg CSLNX* NX#00217 |