Ethyl 2-pyridylacetate
- Product NameEthyl 2-pyridylacetate
- CAS2739-98-2
- MFC9H11NO2
- MW165.19
- EINECS220-365-1
- MOL File2739-98-2.mol
Chemical Properties
| Melting point | 136-137 °C |
| Boiling point | 122 °C/12 mmHg |
| Density | 1.09 |
| refractive index | 1.50 |
| Flash point | 110 °C - closed cup |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in DCM, Methanol |
| form | clear liquid |
| pka | 4.45±0.12(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | Soluble in water. |
| BRN | 123817 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-9(11)7-8-5-3-4-6-10-8/h3-6H,2,7H2,1H3 |
| InChIKey | IUDKTVXSXWAKJO-UHFFFAOYSA-N |
| SMILES | C1(CC(OCC)=O)=NC=CC=C1 |
| CAS DataBase Reference | 2739-98-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 2933399090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
