| Melting point |
25 °C |
| Boiling point |
135 °C/15 mmHg |
| Density |
1.499 g/mL at 25 °C (lit.) |
| refractive index |
1.57 |
| Flash point |
110 °C - closed cup |
| storage temp. |
under inert gas (nitrogen or Argon) at 2-8°C |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Orange to Green |
| Sensitive |
Moisture Sensitive |
| BRN |
2937139 |
| InChI |
InChI=1S/C6H4Cl2O2S/c7-5-2-1-3-6(4-5)11(8,9)10/h1-4H |
| InChIKey |
OINWZUJVEXUHCC-UHFFFAOYSA-N |
| SMILES |
C1(S(Cl)(=O)=O)=CC=CC(Cl)=C1 |
| CAS DataBase Reference |
2888-06-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
3-Chlorobenzenesulfonyl chloride(2888-06-4) |
