| Melting point |
30-32°C |
| Boiling point |
187-188°C 14mm |
| Density |
0.9914 (rough estimate) |
| refractive index |
1.4301 (estimate) |
| Flash point |
187-188°C/14mm |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Methanol (Slightly) |
| form |
powder to lump to clear liquid |
| color |
White or Colorless to Almost white or Almost colorless |
| BRN |
1790424 |
| InChI |
InChI=1S/C14H26O4/c1-17-13(15)11-9-7-5-3-4-6-8-10-12-14(16)18-2/h3-12H2,1-2H3 |
| InChIKey |
IZMOTZDBVPMOFE-UHFFFAOYSA-N |
| SMILES |
C(OC)(=O)CCCCCCCCCCC(OC)=O |
| CAS DataBase Reference |
1731-79-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
Dodecanedioic acid, dimethyl ester(1731-79-9) |
| EPA Substance Registry System |
Dodecanedioic acid, dimethyl ester (1731-79-9) |