| Melting point |
78-81 °C |
| Boiling point |
410.96°C (rough estimate) |
| Density |
0.9700 |
| refractive index |
1.4400 (estimate) |
| Flash point |
>500 |
| storage temp. |
Sealed in dry,Store in freezer, under -20°C |
| solubility |
Soluble in hot ethanol, ether, chloroform, hot acetone,
mineral oil, and fixed oils. Practically insoluble in water, but may
be dispersed in water with the aid of a small amount of soap or
other surfactant. |
| form |
Powder |
| color |
Pure-white or cream-colored, wax-like solid |
| Odor |
faint odor |
| Water Solubility |
Soluble in hot organic solvents.Soluble in hot water. Slightly soluble in ethanol. Insoluble in aliphatic solvents. |
| Merck |
14,4489 |
| Exposure limits |
ACGIH: TWA 10 mg/m3; TWA 3 mg/m3 |
| InChI |
InChI=1S/C21H42O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22/h20,22-23H,2-19H2,1H3 |
| InChIKey |
VBICKXHEKHSIBG-UHFFFAOYSA-N |
| SMILES |
C(OCC(CO)O)(=O)CCCCCCCCCCCCCCCCC |
| CAS DataBase Reference |
31566-31-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Glyceryl monostearate (31566-31-1) |
