| Melting point |
235℃ (Decomposition) |
| Boiling point |
436.08°C (rough estimate) |
| Density |
1.2131 (rough estimate) |
| refractive index |
1.7000 (estimate) |
| Flash point |
>110°(230°F) |
| storage temp. |
Keep in dark place,Inert atmosphere,2-8°C |
| solubility |
H2O: 50 mg/mL, clear, slightly yellow |
| form |
liquid |
| pka |
13.26±0.70(Predicted) |
| color |
White |
| Water Solubility |
Soluble in water at 50mg/ml. May require heating |
| BRN |
93902 |
| Stability |
Stable for 1 year as supplied. Solutions in DMSO or distilled water may be stored at -20° for up to 2 months. |
| InChI |
1S/C12H18N6O3/c1-17(2)10-8-11(15-4-14-10)18(5-16-8)12-9(20)7(13)6(3-19)21-12/h4-7,9,12,19-20H,3,13H2,1-2H3/t6-,7+,9+,12-/m1/s1 |
| InChIKey |
RYSMHWILUNYBFW-GRIPGOBMSA-N |
| SMILES |
CN(C)c1ncnc2n(cnc12)[C@@H]3O[C@H](CO)[C@H](N)[C@@H]3O |
| EPA Substance Registry System |
Adenosine, 3'-amino-3'-deoxy-N,N-dimethyl- (58-60-6) |
