2-Amino-4-chloropyridine
- Product Name2-Amino-4-chloropyridine
- CAS19798-80-2
- CBNumberCB7183078
- MFC5H5ClN2
- MW128.56
- EINECS629-610-0
- MDL NumberMFCD04113820
- MOL File19798-80-2.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 126-127°C |
| Boiling point | 240.8±20.0 °C(Predicted) |
| Density | 1.326±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO, Methanol |
| form | Liquid |
| pka | 5.72±0.11(Predicted) |
| color | Colorless to yellow to brown |
| λmax | 294nm(CHCl3)(lit.) |
| Sensitive | Air & Moisture Sensitive |
| InChI | InChI=1S/C5H5ClN2/c6-4-1-2-8-5(7)3-4/h1-3H,(H2,7,8) |
| InChIKey | RQMWVVBHJMUJNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=CC(Cl)=C1 |
| CAS DataBase Reference | 19798-80-2(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 22-36/37/38 | |||||||||
| Safety Statements | 26 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29333990 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
