3'-Chloroacetophenone
- Product Name3'-Chloroacetophenone
- CAS99-02-5
- CBNumberCB4667827
- MFC8H7ClO
- MW154.59
- EINECS202-721-8
- MDL NumberMFCD00000593
- MOL File99-02-5.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 227-229 °C(lit.) |
| Density | 1.191 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 221 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.191 |
| color | Clear colorless to yellow |
| Sensitive | Lachrymatory |
| BRN | 636318 |
| InChI | InChI=1S/C8H7ClO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| InChIKey | UUWJBXKHMMQDED-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(Cl)=C1)C |
| CAS DataBase Reference | 99-02-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetophenone, 3'-chloro-(99-02-5) |
| EPA Substance Registry System | Ethanone, 1-(3-chlorophenyl)- (99-02-5) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,Xn | |||||||||
| Risk Statements | 36/37/38-36-20/21/22 | |||||||||
| Safety Statements | 26-36-37/39-36/37/39-13-7/9 | |||||||||
| RIDADR | UN 3416 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 19 | |||||||||
| Hazard Note | Harmful/Irritant/Lachrymatory | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29147090 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
