99-02-5
| Name | 3'-Chloroacetophenone |
| CAS | 99-02-5 |
| EINECS(EC#) | 202-721-8 |
| Molecular Formula | C8H7ClO |
| MDL Number | MFCD00000593 |
| Molecular Weight | 154.59 |
| MOL File | 99-02-5.mol |
Chemical Properties
| Appearance | clear colourless to yellow liquid |
| Boiling point | 227-229 °C(lit.) |
| density | 1.191 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 221 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| color | Clear colorless to yellow |
| Specific Gravity | 1.191 |
| Sensitive | Lachrymatory |
| BRN | 636318 |
| InChI | InChI=1S/C8H7ClO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3 |
| InChIKey | UUWJBXKHMMQDED-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=CC(Cl)=C1)C |
| CAS DataBase Reference | 99-02-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetophenone, 3'-chloro-(99-02-5) |
| EPA Substance Registry System | 99-02-5(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3416 6.1/PG 2 |
| WGK Germany | 3 |
| F | 19 |
| Hazard Note | Harmful/Irritant/Lachrymatory |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29147090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |