
704-10-9
| Name | 2,4-Dichloro-5-fluoroacetophenone |
| CAS | 704-10-9 |
| EINECS(EC#) | 615-113-6 |
| Molecular Formula | C8H5Cl2FO |
| MDL Number | MFCD00077499 |
| Molecular Weight | 207.03 |
| MOL File | 704-10-9.mol |
Chemical Properties
| Appearance | white to light yellow cryst. low melting solid |
| Melting point | 33-36 °C |
| Boiling point | 167 °C(lit.) |
| density | 1.425 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Specific Gravity | 1.425 |
| BRN | 3090042 |
| InChI | InChI=1S/C8H5Cl2FO/c1-4(12)5-2-8(11)7(10)3-6(5)9/h2-3H,1H3 |
| InChIKey | FAKJFAMIABOKBW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(F)=C(Cl)C=C1Cl)C |
| CAS DataBase Reference | 704-10-9(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,F |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| REACH Registrations | Active |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
