1-Adamantyl isothiocyanate
- Product Name1-Adamantyl isothiocyanate
- CAS4411-26-1
- CBNumberCB0374480
- MFC11H15NS
- MW193.31
- EINECS224-564-4
- MDL NumberMFCD00074736
- MOL File4411-26-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 166-168 °C (lit.) |
| Density | 1.35 |
| refractive index | 1.5500 (estimate) |
| form | powder to crystal |
| color | White to Orange to Green |
| InChI | InChI=1S/C11H15NS/c13-7-12-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10H,1-6H2 |
| InChIKey | YPKFLUARLJRPQM-UHFFFAOYSA-N |
| SMILES | C12(N=C=S)CC3CC(CC(C3)C1)C2 |
| CAS DataBase Reference | 4411-26-1(CAS DataBase Reference) |
| FDA UNII | V33B5GRD78 |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-37/39 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| HS Code | 2930.90.9250 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|

