99627-05-1
| Name | 3,4,5-Trifluorophenol |
| CAS | 99627-05-1 |
| EINECS(EC#) | 436-160-7 |
| Molecular Formula | C6H3F3O |
| MDL Number | MFCD00042427 |
| Molecular Weight | 148.08 |
| MOL File | 99627-05-1.mol |
Chemical Properties
| Appearance | white to light yellow crystal powder |
| Melting point | 52-55 °C |
| Boiling point | 177°C |
| density | 1.629 g/cm3 (20℃) |
| vapor pressure | 1.7hPa at 25℃ |
| Fp | 177°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 104g/l OECD Test Guideline 105 |
| form | Crystals or Low Melting Solid |
| pka | 8.00±0.23(Predicted) |
| color | Colorless to pale yellow |
| Water Solubility | 104g/L at 20℃ |
| Usage | Intermediates of Liquid Crystals |
| BRN | 8830884 |
| InChI | InChI=1S/C6H3F3O/c7-4-1-3(10)2-5(8)6(4)9/h1-2,10H |
| InChIKey | ZRTWIJKGTUGZJY-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=C(F)C(F)=C1 |
| LogP | 1.9 at 20℃ |
| CAS DataBase Reference | 99627-05-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |    GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H312+H332-H314-H411 |
| Precautionary statements | P260-P273-P280-P301+P310+P330-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C,N,Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Irritant |
| REACH Registrations | Active |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29081900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B |