827-43-0
| Name | 4-Methyl-2-phenyl-1H-imidazole |
| CAS | 827-43-0 |
| EINECS(EC#) | 212-571-5 |
| Molecular Formula | C10H10N2 |
| MDL Number | MFCD00047015 |
| Molecular Weight | 158.2 |
| MOL File | 827-43-0.mol |
Chemical Properties
| Melting point | 180-183 °C (lit.) |
| Boiling point | 352.7±11.0 °C(Predicted) |
| density | 1.109±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 13.22±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 4112 |
| InChI | InChI=1S/C10H10N2/c1-8-7-11-10(12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
| InChIKey | TYOXIFXYEIILLY-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)NC(C)=CN=1 |
| CAS DataBase Reference | 827-43-0(CAS DataBase Reference) |
| EPA Substance Registry System | 827-43-0(EPA Substance) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |