
79669-49-1
| Name | 5-Bromo-2-methylbenzoic acid |
| CAS | 79669-49-1 |
| EINECS(EC#) | 628-605-0 |
| Molecular Formula | C8H7BrO2 |
| MDL Number | MFCD00267350 |
| Molecular Weight | 215.04 |
| MOL File | 79669-49-1.mol |
Chemical Properties
| Melting point | 167-171°C |
| Boiling point | 319.4±30.0 °C(Predicted) |
| density | 1.599±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 3.48±0.25(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C8H7BrO2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| InChIKey | SEENCYZQHCUTSB-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1C |
| CAS DataBase Reference | 79669-49-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
