
793-24-8
| Name | N-(1,3-Dimethylbutyl)-N'-phenyl-p-phenylenediamine |
| CAS | 793-24-8 |
| EINECS(EC#) | 212-344-0 |
| Molecular Formula | C18H24N2 |
| MDL Number | MFCD00072248 |
| Molecular Weight | 268.4 |
| MOL File | 793-24-8.mol |
Chemical Properties
| Melting point | 45-46°C |
| Boiling point | 260°C |
| density | 0.986~1.00g/cm3 |
| refractive index | 1.6300 (estimate) |
| Fp | 204°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | 6.73±0.32(Predicted) |
| color | Light orange to Dark red to Black |
| Water Solubility | <0.1 g/100 mL at 17 ºC |
| Henry's Law Constant | 2.9×103 mol/(m3Pa) at 25℃, Zhang et al. (2010) |
| InChI | InChI=1S/C18H24N2/c1-14(2)13-15(3)19-17-9-11-18(12-10-17)20-16-7-5-4-6-8-16/h4-12,14-15,19-20H,13H2,1-3H3 |
| InChIKey | ZZMVLMVFYMGSMY-UHFFFAOYSA-N |
| SMILES | C1(NC(C)CC(C)C)=CC=C(NC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 793-24-8(CAS DataBase Reference) |
| EPA Substance Registry System | 793-24-8(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | ST0900000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29215190 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 |
| Hazardous Substances Data | 793-24-8(Hazardous Substances Data) |
| Toxicity |

