624-18-0
| Name | p-Phenylenediamine dihydrochloride |
| CAS | 624-18-0 |
| EINECS(EC#) | 210-834-9 |
| Molecular Formula | C6H10Cl2N2 |
| MDL Number | MFCD00013002 |
| Molecular Weight | 181.06 |
| MOL File | 624-18-0.mol |
Chemical Properties
| Appearance | Off-white crystal powder |
| Melting point | >200°C |
| storage temp. | Store below +30°C. |
| solubility | Methanol (Slightly), Water (Slightly) |
| Colour Index | 76061 |
| form | Crystalline Powder |
| color | White to purple-gray |
| Stability: | Stable. Incompatible with acids, strong oxidizing agents. |
| Water Solubility | >=10 g/100 mL at 21 ºC |
| Merck | 14,7285 |
| BRN | 3911749 |
| Cosmetics Ingredients Functions | HAIR DYEING |
| InChI | InChI=1S/C6H8N2.2ClH/c7-5-1-2-6(8)4-3-5;;/h1-4H,7-8H2;2*1H |
| InChIKey | IYXMNTLBLQNMLM-UHFFFAOYSA-N |
| SMILES | C1(N)C=CC(N)=CC=1.Cl.Cl |
| CAS DataBase Reference | 624-18-0(CAS DataBase Reference) |
| EPA Substance Registry System | 624-18-0(EPA Substance) |
Safety Data
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H317-H319-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352+P312-P304+P340+P311-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1673 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ST0350000 |
| F | 8-9 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29215119 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Skin Sens. 1 |
| Hazardous Substances Data | 624-18-0(Hazardous Substances Data) |
| Toxicity |