
75980-60-8
| Name | Diphenyl(2,4,6-trimethylbenzoyl)phosphine oxide |
| CAS | 75980-60-8 |
| EINECS(EC#) | 278-355-8 |
| Molecular Formula | C22H21O2P |
| MDL Number | MFCD00192110 |
| Molecular Weight | 348.37 |
| MOL File | 75980-60-8.mol |
Chemical Properties
| Appearance | white or cream powder |
| Melting point | 88-92 °C(lit.) |
| Boiling point | 519.6±60.0 °C(Predicted) |
| density | 1.12 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | 3.4mg/L at 20℃ |
| λmax | 400nm(DMF)(lit.) |
| Cosmetics Ingredients Functions | NAIL SCULPTING |
| InChI | 1S/C22H21O2P/c1-16-14-17(2)21(18(3)15-16)22(23)25(24,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,1-3H3 |
| InChIKey | VFHVQBAGLAREND-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(c(C)c1)C(=O)P(=O)(c2ccccc2)c3ccccc3 |
| LogP | 3.1 at 23℃ |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Warning |
| Hazard statements | H317-H361f-H411 |
| Precautionary statements | P202-P261-P273-P280-P302+P352-P308+P313 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | SZ0395000 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Repr. 2 Skin Sens. 1 |


