4559-70-0
| Name | Diphenylphosphine oxide |
| CAS | 4559-70-0 |
| EINECS(EC#) | 625-671-2 |
| Molecular Formula | C12H11OP |
| MDL Number | MFCD00002079 |
| Molecular Weight | 202.19 |
| MOL File | 4559-70-0.mol |
Chemical Properties
| Appearance | Yellow to light orange crystals |
| Melting point | 56-57 °C(lit.) |
| Boiling point | 102-105°C 0,2mm |
| refractive index | 1.608-1.61 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystals |
| pka | 25 (approx) |
| color | Yellow to light orange |
| Water Solubility | Slightly soluble in water. |
| Sensitive | Moisture Sensitive |
| Detection Methods | HPLC,NMR |
| InChI | InChI=1S/C12H11OP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | ASUOLLHGALPRFK-UHFFFAOYSA-N |
| SMILES | P(=O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| CAS DataBase Reference | 4559-70-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |