
71868-10-5
| Name | 2-Methyl-4'-(methylthio)-2-morpholinopropiophenone |
| CAS | 71868-10-5 |
| EINECS(EC#) | 400-600-6 |
| Molecular Formula | C15H21NO2S |
| MDL Number | MFCD00083014 |
| Molecular Weight | 279.4 |
| MOL File | 71868-10-5.mol |
Chemical Properties
| Melting point | 74-76 °C(lit.) |
| Boiling point | 210°C/76mmHg(lit.) |
| density | 1.15±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| Fp | 165℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 162 in mg/100g standard fat at 20 ℃ |
| form | powder to crystal |
| pka | 4.77±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 17.9mg/L at 20℃ |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C15H21NO2S/c1-15(2,16-8-10-18-11-9-16)14(17)12-4-6-13(19-3)7-5-12/h4-7H,8-11H2,1-3H3 |
| InChIKey | LWRBVKNFOYUCNP-UHFFFAOYSA-N |
| SMILES | CSc1ccc(cc1)C(=O)C(C)(C)N2CCOCC2 |
| LogP | 3.09 at 25℃ |
| CAS DataBase Reference | 71868-10-5(CAS DataBase Reference) |
| EPA Substance Registry System | 71868-10-5(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H360FD-H411 |
| Precautionary statements | P202-P264-P270-P273-P301+P312-P308+P313 |
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Repr. 1B |


