
52829-07-9
| Name | Bis(2,2,6,6-tetramethyl-4-piperidyl)sebacate |
| CAS | 52829-07-9 |
| EINECS(EC#) | 258-207-9 |
| Molecular Formula | C28H50N2O4-2 |
| MDL Number | MFCD00134709 |
| Molecular Weight | 478.71 |
| MOL File | 52829-07-9.mol |
Chemical Properties
| Melting point | 82-85 °C(lit.) |
| Boiling point | 499.8±45.0 °C(Predicted) |
| density | 1.01±0.1 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| Fp | 421 °F |
| storage temp. | 2-30°C |
| solubility | acetone: 19 % (w/w) at 20 °C |
| form | powder to crystal |
| pka | 10.49±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 18.8mg/L at 23℃ |
| InChI | InChI=1S/C28H52N2O4/c1-25(2)17-21(18-26(3,4)29-25)33-23(31)15-13-11-9-10-12-14-16-24(32)34-22-19-27(5,6)30-28(7,8)20-22/h21-22,29-30H,9-20H2,1-8H3 |
| InChIKey | XITRBUPOXXBIJN-UHFFFAOYSA-N |
| SMILES | C(OC1CC(C)(C)NC(C)(C)C1)(=O)CCCCCCCCC(OC1CC(C)(C)NC(C)(C)C1)=O |
| LogP | 0.35 at 25℃ |
| CAS DataBase Reference | 52829-07-9(CAS DataBase Reference) |
| EPA Substance Registry System | 52829-07-9(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS09 |
| Signal word | Danger |
| Hazard statements | H318-H410 |
| Precautionary statements | P273-P280-P305+P351+P338-P391-P501 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | HD8315000 |
| TSCA | Yes |
| REACH Registrations | Active |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 2 Eye Dam. 1 |


;