7368-78-7
| Name | 4-Bromo-2-methoxyphenol |
| CAS | 7368-78-7 |
| Molecular Formula | C7H7BrO2 |
| MDL Number | MFCD00051937 |
| Molecular Weight | 203.03 |
| MOL File | 7368-78-7.mol |
Chemical Properties
| Melting point | 34-37 °C (lit.) |
| Boiling point | 129-132°C 12mm |
| density | 1.585±0.06 g/cm3(Predicted) |
| Fp | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Low Melting Solid or Crystalline Solid |
| pka | 9.40±0.18(Predicted) |
| color | Colorless to white to pale brown |
| Water Solubility | Slightly soluble in water. |
| BRN | 2045286 |
| InChI | InChI=1S/C7H7BrO2/c1-10-7-4-5(8)2-3-6(7)9/h2-4,9H,1H3 |
| InChIKey | WHSIIJQOEGXWSN-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(Br)C=C1OC |
| CAS DataBase Reference | 7368-78-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Bromoguaiacol(7368-78-7) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
